C20H30N4S2 — CID 21051820
ethyl N'-[2-[4-(4-cyclopentylpiperazin-1-yl)phenyl]ethanethioyl]carbamimidothioate (PubChem CID 21051820) has the molecular formula C20H30N4S2 and a molecular weight of 390.62 g/mol. Its IUPAC name is ethyl N'-[2-[4-(4-cyclopentylpiperazin-1-yl)phenyl]ethanethioyl]carbamimidothioate.
| Compound Name | ethyl N'-[2-[4-(4-cyclopentylpiperazin-1-yl)phenyl]ethanethioyl]carbamimidothioate |
|---|---|
| PubChem CID | 21051820 |
| Molecular Formula | C20H30N4S2 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | ethyl N'-[2-[4-(4-cyclopentylpiperazin-1-yl)phenyl]ethanethioyl]carbamimidothioate |
| SMILES | CCS/C(N)=N\C(=S)Cc1ccc(N2CCN(C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C20H30N4S2/c1-2-26-20(21)22-19(25)15-16-7-9-18(10-8-16)24-13-11-23(12-14-24)17-5-3-4-6-17/h7-10,17H,2-6,11-15H2,1H3,(H2,21,22,25) |
| InChIKey | CYBYTWUDXGYGNF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|