C24H38N4S2 — CID 142154085
1-[4-(4-butan-2-ylpiperazin-1-yl)phenyl]-3-[1-(cyclohexylmethylsulfanyl)ethenyl]thiourea (PubChem CID 142154085) has the molecular formula C24H38N4S2 and a molecular weight of 446.73 g/mol. Its IUPAC name is 1-[4-(4-butan-2-ylpiperazin-1-yl)phenyl]-3-[1-(cyclohexylmethylsulfanyl)ethenyl]thiourea.
| Compound Name | 1-[4-(4-butan-2-ylpiperazin-1-yl)phenyl]-3-[1-(cyclohexylmethylsulfanyl)ethenyl]thiourea |
|---|---|
| PubChem CID | 142154085 |
| Molecular Formula | C24H38N4S2 |
| Molecular Weight | 446.73 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 1-[4-(4-butan-2-ylpiperazin-1-yl)phenyl]-3-[1-(cyclohexylmethylsulfanyl)ethenyl]thiourea |
| SMILES | C=C(NC(=S)Nc1ccc(N2CCN(C(C)CC)CC2)cc1)SCC1CCCCC1 |
| InChI | InChI=1S/C24H38N4S2/c1-4-19(2)27-14-16-28(17-15-27)23-12-10-22(11-13-23)26-24(29)25-20(3)30-18-21-8-6-5-7-9-21/h10-13,19,21H,3-9,14-18H2,1-2H3,(H2,25,26,29) |
| InChIKey | HKBWHAGZHUZBHL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.73 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|