C24H35N3O4 — CID 3578516
ethyl 4-[4-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]anilino]-4-oxobutanoate (PubChem CID 3578516) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is ethyl 4-[4-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]anilino]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 3578516 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | ethyl 4-[4-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]anilino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1ccc(N2CCN(C(=O)CCC3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C24H35N3O4/c1-2-31-24(30)14-12-22(28)25-20-8-10-21(11-9-20)26-15-17-27(18-16-26)23(29)13-7-19-5-3-4-6-19/h8-11,19H,2-7,12-18H2,1H3,(H,25,28) |
| InChIKey | DTAXMVLDJVLSGN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|