C29H34N4O2 — CID 1056375
1-[4-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]phenyl]-3-naphthalen-1-ylurea (PubChem CID 1056375) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 1-[4-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]phenyl]-3-naphthalen-1-ylurea.
| Compound Name | 1-[4-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]phenyl]-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 1056375 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 1-[4-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]phenyl]-3-naphthalen-1-ylurea |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)CCC3CCCC3)CC2)cc1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C29H34N4O2/c34-28(17-12-22-6-1-2-7-22)33-20-18-32(19-21-33)25-15-13-24(14-16-25)30-29(35)31-27-11-5-9-23-8-3-4-10-26(23)27/h3-5,8-11,13-16,22H,1-2,6-7,12,17-21H2,(H2,30,31,35) |
| InChIKey | OSIBYTQXHBBEAO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|