C25H30N4O4 — CID 1056018
N-[4-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]phenyl]-3-nitrobenzamide (PubChem CID 1056018) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-[4-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]phenyl]-3-nitrobenzamide.
| Compound Name | N-[4-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 1056018 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | N-[4-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]phenyl]-3-nitrobenzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)CCC3CCCC3)CC2)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H30N4O4/c30-24(13-8-19-4-1-2-5-19)28-16-14-27(15-17-28)22-11-9-21(10-12-22)26-25(31)20-6-3-7-23(18-20)29(32)33/h3,6-7,9-12,18-19H,1-2,4-5,8,13-17H2,(H,26,31) |
| InChIKey | YLHZFXHOJURFQS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|