C27H43N3O2 — CID 1056160
3-cyclopentyl-N-[4-[4-[(3R)-3,5,5-trimethylhexanoyl]piperazin-1-yl]phenyl]propanamide (PubChem CID 1056160) has the molecular formula C27H43N3O2 and a molecular weight of 441.66 g/mol. Its IUPAC name is 3-cyclopentyl-N-[4-[4-[(3R)-3,5,5-trimethylhexanoyl]piperazin-1-yl]phenyl]propanamide.
| Compound Name | 3-cyclopentyl-N-[4-[4-[(3R)-3,5,5-trimethylhexanoyl]piperazin-1-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 1056160 |
| Molecular Formula | C27H43N3O2 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.34 |
| IUPAC Name | 3-cyclopentyl-N-[4-[4-[(3R)-3,5,5-trimethylhexanoyl]piperazin-1-yl]phenyl]propanamide |
| SMILES | C[C@@H](CC(=O)N1CCN(c2ccc(NC(=O)CCC3CCCC3)cc2)CC1)CC(C)(C)C |
| InChI | InChI=1S/C27H43N3O2/c1-21(20-27(2,3)4)19-26(32)30-17-15-29(16-18-30)24-12-10-23(11-13-24)28-25(31)14-9-22-7-5-6-8-22/h10-13,21-22H,5-9,14-20H2,1-4H3,(H,28,31)/t21-/m0/s1 |
| InChIKey | WRZIIYWKZSRGTD-NRFANRHFSA-N |
| XLogP | 5.71 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|