C27H37N3O3 — CID 3949255
3-methoxy-N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 3949255) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is 3-methoxy-N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 3-methoxy-N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 3949255 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 3-methoxy-N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(N3CCN(C(=O)CC(C)CC(C)(C)C)CC3)cc2)c1 |
| InChI | InChI=1S/C27H37N3O3/c1-20(19-27(2,3)4)17-25(31)30-15-13-29(14-16-30)23-11-9-22(10-12-23)28-26(32)21-7-6-8-24(18-21)33-5/h6-12,18,20H,13-17,19H2,1-5H3,(H,28,32) |
| InChIKey | ZVZRGFLXYXHPSZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|