C24H39N3O2 — CID 3428512
N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]pentanamide (PubChem CID 3428512) has the molecular formula C24H39N3O2 and a molecular weight of 401.60 g/mol. Its IUPAC name is N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]pentanamide.
| Compound Name | N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]pentanamide |
|---|---|
| PubChem CID | 3428512 |
| Molecular Formula | C24H39N3O2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(N2CCN(C(=O)CC(C)CC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H39N3O2/c1-6-7-8-22(28)25-20-9-11-21(12-10-20)26-13-15-27(16-14-26)23(29)17-19(2)18-24(3,4)5/h9-12,19H,6-8,13-18H2,1-5H3,(H,25,28) |
| InChIKey | XZZLRLWAVNWXHB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|