C25H41N3O2 — CID 5128882
N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]hexanamide (PubChem CID 5128882) has the molecular formula C25H41N3O2 and a molecular weight of 415.62 g/mol. Its IUPAC name is N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]hexanamide.
| Compound Name | N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]hexanamide |
|---|---|
| PubChem CID | 5128882 |
| Molecular Formula | C25H41N3O2 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.32 |
| IUPAC Name | N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(N2CCN(C(=O)CC(C)CC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C25H41N3O2/c1-6-7-8-9-23(29)26-21-10-12-22(13-11-21)27-14-16-28(17-15-27)24(30)18-20(2)19-25(3,4)5/h10-13,20H,6-9,14-19H2,1-5H3,(H,26,29) |
| InChIKey | LAIHLPPQGGWVPL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|