C28H39N3O2 — CID 5205904
4-ethyl-N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 5205904) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is 4-ethyl-N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 4-ethyl-N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 5205904 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 4-ethyl-N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | CCc1ccc(C(=O)Nc2ccc(N3CCN(C(=O)CC(C)CC(C)(C)C)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H39N3O2/c1-6-22-7-9-23(10-8-22)27(33)29-24-11-13-25(14-12-24)30-15-17-31(18-16-30)26(32)19-21(2)20-28(3,4)5/h7-14,21H,6,15-20H2,1-5H3,(H,29,33) |
| InChIKey | FOIWEOJHKHEDCD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|