C27H37N3O2 — CID 3667014
2-phenyl-N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 3667014) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is 2-phenyl-N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-phenyl-N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 3667014 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | 2-phenyl-N-[4-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | CC(CC(=O)N1CCN(c2ccc(NC(=O)Cc3ccccc3)cc2)CC1)CC(C)(C)C |
| InChI | InChI=1S/C27H37N3O2/c1-21(20-27(2,3)4)18-26(32)30-16-14-29(15-17-30)24-12-10-23(11-13-24)28-25(31)19-22-8-6-5-7-9-22/h5-13,21H,14-20H2,1-4H3,(H,28,31) |
| InChIKey | QBPORZUYOIINOI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|