C29H41N3O2 — CID 3880264
N-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]octanamide (PubChem CID 3880264) has the molecular formula C29H41N3O2 and a molecular weight of 463.67 g/mol. Its IUPAC name is N-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]octanamide.
| Compound Name | N-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]octanamide |
|---|---|
| PubChem CID | 3880264 |
| Molecular Formula | C29H41N3O2 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.32 |
| IUPAC Name | N-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1ccc(N2CCN(C(=O)c3ccc(C(C)(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H41N3O2/c1-5-6-7-8-9-10-27(33)30-25-15-17-26(18-16-25)31-19-21-32(22-20-31)28(34)23-11-13-24(14-12-23)29(2,3)4/h11-18H,5-10,19-22H2,1-4H3,(H,30,33) |
| InChIKey | LFMZOJWGIDCXEE-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|