C30H36N4O2 — CID 1056874
1-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]-3-(3,4-dimethylphenyl)urea (PubChem CID 1056874) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is 1-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]-3-(3,4-dimethylphenyl)urea.
| Compound Name | 1-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]-3-(3,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 1056874 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 1-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]-3-(3,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(N3CCN(C(=O)c4ccc(C(C)(C)C)cc4)CC3)cc2)cc1C |
| InChI | InChI=1S/C30H36N4O2/c1-21-6-11-26(20-22(21)2)32-29(36)31-25-12-14-27(15-13-25)33-16-18-34(19-17-33)28(35)23-7-9-24(10-8-23)30(3,4)5/h6-15,20H,16-19H2,1-5H3,(H2,31,32,36) |
| InChIKey | RFTOMSHBXCLNHL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|