C31H45N3O2 — CID 5188422
N-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]decanamide (PubChem CID 5188422) has the molecular formula C31H45N3O2 and a molecular weight of 491.72 g/mol. Its IUPAC name is N-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]decanamide.
| Compound Name | N-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]decanamide |
|---|---|
| PubChem CID | 5188422 |
| Molecular Formula | C31H45N3O2 |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.35 |
| IUPAC Name | N-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(N2CCN(C(=O)c3ccc(C(C)(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H45N3O2/c1-5-6-7-8-9-10-11-12-29(35)32-27-17-19-28(20-18-27)33-21-23-34(24-22-33)30(36)25-13-15-26(16-14-25)31(2,3)4/h13-20H,5-12,21-24H2,1-4H3,(H,32,35) |
| InChIKey | LSBIUSSMFGCJFY-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|