C25H41N3O2 — CID 4553129
N-[4-[4-(2-ethylbutanoyl)piperazin-1-yl]phenyl]nonanamide (PubChem CID 4553129) has the molecular formula C25H41N3O2 and a molecular weight of 415.62 g/mol. Its IUPAC name is N-[4-[4-(2-ethylbutanoyl)piperazin-1-yl]phenyl]nonanamide.
| Compound Name | N-[4-[4-(2-ethylbutanoyl)piperazin-1-yl]phenyl]nonanamide |
|---|---|
| PubChem CID | 4553129 |
| Molecular Formula | C25H41N3O2 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.32 |
| IUPAC Name | N-[4-[4-(2-ethylbutanoyl)piperazin-1-yl]phenyl]nonanamide |
| SMILES | CCCCCCCCC(=O)Nc1ccc(N2CCN(C(=O)C(CC)CC)CC2)cc1 |
| InChI | InChI=1S/C25H41N3O2/c1-4-7-8-9-10-11-12-24(29)26-22-13-15-23(16-14-22)27-17-19-28(20-18-27)25(30)21(5-2)6-3/h13-16,21H,4-12,17-20H2,1-3H3,(H,26,29) |
| InChIKey | VWFSTVFTBHZHOX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|