C33H44N4O4 — CID 43878316
N,N'-bis[4-(piperidine-1-carbonyl)phenyl]nonanediamide (PubChem CID 43878316) has the molecular formula C33H44N4O4 and a molecular weight of 560.74 g/mol. Its IUPAC name is N,N'-bis[4-(piperidine-1-carbonyl)phenyl]nonanediamide.
| Compound Name | N,N'-bis[4-(piperidine-1-carbonyl)phenyl]nonanediamide |
|---|---|
| PubChem CID | 43878316 |
| Molecular Formula | C33H44N4O4 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | N,N'-bis[4-(piperidine-1-carbonyl)phenyl]nonanediamide |
| SMILES | O=C(CCCCCCCC(=O)Nc1ccc(C(=O)N2CCCCC2)cc1)Nc1ccc(C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C33H44N4O4/c38-30(34-28-18-14-26(15-19-28)32(40)36-22-8-4-9-23-36)12-6-2-1-3-7-13-31(39)35-29-20-16-27(17-21-29)33(41)37-24-10-5-11-25-37/h14-21H,1-13,22-25H2,(H,34,38)(H,35,39) |
| InChIKey | CFGKDPDCAIZGCL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|