C19H30N4O2 — CID 119861246
7-amino-N-[4-(4-methylpiperazine-1-carbonyl)phenyl]heptanamide (PubChem CID 119861246) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 7-amino-N-[4-(4-methylpiperazine-1-carbonyl)phenyl]heptanamide.
| Compound Name | 7-amino-N-[4-(4-methylpiperazine-1-carbonyl)phenyl]heptanamide |
|---|---|
| PubChem CID | 119861246 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 7-amino-N-[4-(4-methylpiperazine-1-carbonyl)phenyl]heptanamide |
| SMILES | CN1CCN(C(=O)c2ccc(NC(=O)CCCCCCN)cc2)CC1 |
| InChI | InChI=1S/C19H30N4O2/c1-22-12-14-23(15-13-22)19(25)16-7-9-17(10-8-16)21-18(24)6-4-2-3-5-11-20/h7-10H,2-6,11-15,20H2,1H3,(H,21,24) |
| InChIKey | KHTGCKUCAWCBAE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|