C22H27N3O2 — CID 119761257
7-amino-N-[4-(2,3-dihydroindole-1-carbonyl)phenyl]heptanamide (PubChem CID 119761257) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 7-amino-N-[4-(2,3-dihydroindole-1-carbonyl)phenyl]heptanamide.
| Compound Name | 7-amino-N-[4-(2,3-dihydroindole-1-carbonyl)phenyl]heptanamide |
|---|---|
| PubChem CID | 119761257 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 7-amino-N-[4-(2,3-dihydroindole-1-carbonyl)phenyl]heptanamide |
| SMILES | NCCCCCCC(=O)Nc1ccc(C(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C22H27N3O2/c23-15-6-2-1-3-9-21(26)24-19-12-10-18(11-13-19)22(27)25-16-14-17-7-4-5-8-20(17)25/h4-5,7-8,10-13H,1-3,6,9,14-16,23H2,(H,24,26) |
| InChIKey | FIMFRVAVBLZZKW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|