C20H34Cl2N4O3 — CID 119866731
7-amino-N-[2-methoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]heptanamide;dihydrochloride (PubChem CID 119866731) has the molecular formula C20H34Cl2N4O3 and a molecular weight of 449.42 g/mol. Its IUPAC name is 7-amino-N-[2-methoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]heptanamide;dihydrochloride.
| Compound Name | 7-amino-N-[2-methoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]heptanamide;dihydrochloride |
|---|---|
| PubChem CID | 119866731 |
| Molecular Formula | C20H34Cl2N4O3 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 7-amino-N-[2-methoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]heptanamide;dihydrochloride |
| SMILES | COc1ccc(C(=O)N2CCN(C)CC2)cc1NC(=O)CCCCCCN.Cl.Cl |
| InChI | InChI=1S/C20H32N4O3.2ClH/c1-23-11-13-24(14-12-23)20(26)16-8-9-18(27-2)17(15-16)22-19(25)7-5-3-4-6-10-21;;/h8-9,15H,3-7,10-14,21H2,1-2H3,(H,22,25);2*1H |
| InChIKey | KYZYLDVEZQKUPR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|