C19H30ClN3O2S — CID 119761404
7-amino-N-[2-methyl-4-(thiomorpholine-4-carbonyl)phenyl]heptanamide;hydrochloride (PubChem CID 119761404) has the molecular formula C19H30ClN3O2S and a molecular weight of 399.99 g/mol. Its IUPAC name is 7-amino-N-[2-methyl-4-(thiomorpholine-4-carbonyl)phenyl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[2-methyl-4-(thiomorpholine-4-carbonyl)phenyl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119761404 |
| Molecular Formula | C19H30ClN3O2S |
| Molecular Weight | 399.99 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 7-amino-N-[2-methyl-4-(thiomorpholine-4-carbonyl)phenyl]heptanamide;hydrochloride |
| SMILES | Cc1cc(C(=O)N2CCSCC2)ccc1NC(=O)CCCCCCN.Cl |
| InChI | InChI=1S/C19H29N3O2S.ClH/c1-15-14-16(19(24)22-10-12-25-13-11-22)7-8-17(15)21-18(23)6-4-2-3-5-9-20;/h7-8,14H,2-6,9-13,20H2,1H3,(H,21,23);1H |
| InChIKey | UHAKQYDSKUXDOU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.99 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|