C12H17N3OS — CID 63211977
(4-hydrazinyl-3-methylphenyl)-thiomorpholin-4-ylmethanone (PubChem CID 63211977) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is (4-hydrazinyl-3-methylphenyl)-thiomorpholin-4-ylmethanone.
| Compound Name | (4-hydrazinyl-3-methylphenyl)-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 63211977 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (4-hydrazinyl-3-methylphenyl)-thiomorpholin-4-ylmethanone |
| SMILES | Cc1cc(C(=O)N2CCSCC2)ccc1NN |
| InChI | InChI=1S/C12H17N3OS/c1-9-8-10(2-3-11(9)14-13)12(16)15-4-6-17-7-5-15/h2-3,8,14H,4-7,13H2,1H3 |
| InChIKey | HKZZRDJMFFYYBT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|