C15H17F3N2O2S2 — CID 51132350
N-[2-methyl-4-(thiomorpholine-4-carbonyl)phenyl]-2-(trifluoromethylsulfanyl)acetamide (PubChem CID 51132350) has the molecular formula C15H17F3N2O2S2 and a molecular weight of 378.44 g/mol. Its IUPAC name is N-[2-methyl-4-(thiomorpholine-4-carbonyl)phenyl]-2-(trifluoromethylsulfanyl)acetamide.
| Compound Name | N-[2-methyl-4-(thiomorpholine-4-carbonyl)phenyl]-2-(trifluoromethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 51132350 |
| Molecular Formula | C15H17F3N2O2S2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-[2-methyl-4-(thiomorpholine-4-carbonyl)phenyl]-2-(trifluoromethylsulfanyl)acetamide |
| SMILES | Cc1cc(C(=O)N2CCSCC2)ccc1NC(=O)CSC(F)(F)F |
| InChI | InChI=1S/C15H17F3N2O2S2/c1-10-8-11(14(22)20-4-6-23-7-5-20)2-3-12(10)19-13(21)9-24-15(16,17)18/h2-3,8H,4-7,9H2,1H3,(H,19,21) |
| InChIKey | PQHFYZNSPLNIAO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |