C10H9F3INOS — CID 55667551
N-(4-iodo-2-methylphenyl)-2-(trifluoromethylsulfanyl)acetamide (PubChem CID 55667551) has the molecular formula C10H9F3INOS and a molecular weight of 375.15 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-2-(trifluoromethylsulfanyl)acetamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-2-(trifluoromethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 55667551 |
| Molecular Formula | C10H9F3INOS |
| Molecular Weight | 375.15 g/mol |
| Exact Mass | 374.94 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-2-(trifluoromethylsulfanyl)acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)CSC(F)(F)F |
| InChI | InChI=1S/C10H9F3INOS/c1-6-4-7(14)2-3-8(6)15-9(16)5-17-10(11,12)13/h2-4H,5H2,1H3,(H,15,16) |
| InChIKey | MMKHJYXIINFHEH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.15 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|