C12H14INO3 — CID 683994
methyl 4-(4-iodo-2-methylanilino)-4-oxobutanoate (PubChem CID 683994) has the molecular formula C12H14INO3 and a molecular weight of 347.15 g/mol. Its IUPAC name is methyl 4-(4-iodo-2-methylanilino)-4-oxobutanoate.
| Compound Name | methyl 4-(4-iodo-2-methylanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 683994 |
| Molecular Formula | C12H14INO3 |
| Molecular Weight | 347.15 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | methyl 4-(4-iodo-2-methylanilino)-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)Nc1ccc(I)cc1C |
| InChI | InChI=1S/C12H14INO3/c1-8-7-9(13)3-4-10(8)14-11(15)5-6-12(16)17-2/h3-4,7H,5-6H2,1-2H3,(H,14,15) |
| InChIKey | AEHPDZWXCFQAAA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.15 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|