C14H16INO4 — CID 8627070
[2-(4-iodo-2-methylanilino)-2-oxoethyl] 4-oxopentanoate (PubChem CID 8627070) has the molecular formula C14H16INO4 and a molecular weight of 389.19 g/mol. Its IUPAC name is [2-(4-iodo-2-methylanilino)-2-oxoethyl] 4-oxopentanoate.
| Compound Name | [2-(4-iodo-2-methylanilino)-2-oxoethyl] 4-oxopentanoate |
|---|---|
| PubChem CID | 8627070 |
| Molecular Formula | C14H16INO4 |
| Molecular Weight | 389.19 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | [2-(4-iodo-2-methylanilino)-2-oxoethyl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OCC(=O)Nc1ccc(I)cc1C |
| InChI | InChI=1S/C14H16INO4/c1-9-7-11(15)4-5-12(9)16-13(18)8-20-14(19)6-3-10(2)17/h4-5,7H,3,6,8H2,1-2H3,(H,16,18) |
| InChIKey | UCTYXFZOKIKBDC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|