C19H22INO4 — CID 55883007
N-(4-iodo-2-methylphenyl)-3-(2,3,4-trimethoxyphenyl)propanamide (PubChem CID 55883007) has the molecular formula C19H22INO4 and a molecular weight of 455.29 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-3-(2,3,4-trimethoxyphenyl)propanamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-3-(2,3,4-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 55883007 |
| Molecular Formula | C19H22INO4 |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-3-(2,3,4-trimethoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)Nc2ccc(I)cc2C)c(OC)c1OC |
| InChI | InChI=1S/C19H22INO4/c1-12-11-14(20)7-8-15(12)21-17(22)10-6-13-5-9-16(23-2)19(25-4)18(13)24-3/h5,7-9,11H,6,10H2,1-4H3,(H,21,22) |
| InChIKey | GFFYYFAKPCVDHO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|