C19H20INO3 — CID 26054584
N-(4-iodo-2-methylphenyl)-2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetamide (PubChem CID 26054584) has the molecular formula C19H20INO3 and a molecular weight of 437.28 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 26054584 |
| Molecular Formula | C19H20INO3 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetamide |
| SMILES | C/C=C/c1ccc(OCC(=O)Nc2ccc(I)cc2C)c(OC)c1 |
| InChI | InChI=1S/C19H20INO3/c1-4-5-14-6-9-17(18(11-14)23-3)24-12-19(22)21-16-8-7-15(20)10-13(16)2/h4-11H,12H2,1-3H3,(H,21,22)/b5-4+ |
| InChIKey | JPHXOPZPOMEZMW-SNAWJCMRSA-N |
| XLogP | 4.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|