C25H25N3O4 — CID 18279710
2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]-N-[4-(phenylcarbamoylamino)phenyl]acetamide (PubChem CID 18279710) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]-N-[4-(phenylcarbamoylamino)phenyl]acetamide.
| Compound Name | 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]-N-[4-(phenylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 18279710 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]-N-[4-(phenylcarbamoylamino)phenyl]acetamide |
| SMILES | C/C=C/c1ccc(OCC(=O)Nc2ccc(NC(=O)Nc3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C25H25N3O4/c1-3-7-18-10-15-22(23(16-18)31-2)32-17-24(29)26-20-11-13-21(14-12-20)28-25(30)27-19-8-5-4-6-9-19/h3-16H,17H2,1-2H3,(H,26,29)(H2,27,28,30)/b7-3+ |
| InChIKey | PMMYAUGEKQOETA-XVNBXDOJSA-N |
| XLogP | 5.39 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |