C16H22N2O4 — CID 95383426
N-[(1R)-1-cyanopropyl]-3-(2,3,4-trimethoxyphenyl)propanamide (PubChem CID 95383426) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is N-[(1R)-1-cyanopropyl]-3-(2,3,4-trimethoxyphenyl)propanamide.
| Compound Name | N-[(1R)-1-cyanopropyl]-3-(2,3,4-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 95383426 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-[(1R)-1-cyanopropyl]-3-(2,3,4-trimethoxyphenyl)propanamide |
| SMILES | CC[C@H](C#N)NC(=O)CCc1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C16H22N2O4/c1-5-12(10-17)18-14(19)9-7-11-6-8-13(20-2)16(22-4)15(11)21-3/h6,8,12H,5,7,9H2,1-4H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | NEAYMDFINVCUIV-GFCCVEGCSA-N |
| XLogP | 2.06 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |