C29H34N4O3 — CID 42663789
1-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]-3-(4-methoxyphenyl)urea (PubChem CID 42663789) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is 1-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 42663789 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 1-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(N3CCN(C(=O)c4ccc(C(C)(C)C)cc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H34N4O3/c1-29(2,3)22-7-5-21(6-8-22)27(34)33-19-17-32(18-20-33)25-13-9-23(10-14-25)30-28(35)31-24-11-15-26(36-4)16-12-24/h5-16H,17-20H2,1-4H3,(H2,30,31,35) |
| InChIKey | FCTHRYYQNFYEIZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|