C20H29N3O4 — CID 981797
trans-(1S,2S)-2-[[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 981797) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is trans-(1S,2S)-2-[[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-2-[[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 981797 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | trans-(1S,2S)-2-[[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCC[C@@H]1C(=O)Nc1ccc(N2CCN(CCO)CC2)cc1 |
| InChI | InChI=1S/C20H29N3O4/c24-14-13-22-9-11-23(12-10-22)16-7-5-15(6-8-16)21-19(25)17-3-1-2-4-18(17)20(26)27/h5-8,17-18,24H,1-4,9-14H2,(H,21,25)(H,26,27)/t17-,18-/m0/s1 |
| InChIKey | LMTQNRYNZDAOAQ-ROUUACIJSA-N |
| XLogP | 1.63 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|