C18H24N2O4 — CID 27516821
trans-(1R,2R)-2-[(4-morpholin-4-ylphenyl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 27516821) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is trans-(1R,2R)-2-[(4-morpholin-4-ylphenyl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-[(4-morpholin-4-ylphenyl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 27516821 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | trans-(1R,2R)-2-[(4-morpholin-4-ylphenyl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCC[C@H]1C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H24N2O4/c21-17(15-3-1-2-4-16(15)18(22)23)19-13-5-7-14(8-6-13)20-9-11-24-12-10-20/h5-8,15-16H,1-4,9-12H2,(H,19,21)(H,22,23)/t15-,16-/m1/s1 |
| InChIKey | QXGUCBMZUXIMMV-HZPDHXFCSA-N |
| XLogP | 2.35 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|