C20H29N3O3 — CID 981803
trans-(1S,2S)-2-[[4-(4-ethylpiperazin-1-yl)phenyl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 981803) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is trans-(1S,2S)-2-[[4-(4-ethylpiperazin-1-yl)phenyl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-2-[[4-(4-ethylpiperazin-1-yl)phenyl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 981803 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | trans-(1S,2S)-2-[[4-(4-ethylpiperazin-1-yl)phenyl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | CCN1CCN(c2ccc(NC(=O)[C@H]3CCCC[C@@H]3C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C20H29N3O3/c1-2-22-11-13-23(14-12-22)16-9-7-15(8-10-16)21-19(24)17-5-3-4-6-18(17)20(25)26/h7-10,17-18H,2-6,11-14H2,1H3,(H,21,24)(H,25,26)/t17-,18-/m0/s1 |
| InChIKey | MSYFKEAXXUVIAV-ROUUACIJSA-N |
| XLogP | 2.66 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|