C32H37ClN8 — CID 11757705
2-benzyl-1-[4-[4-[4-[(N'-benzylcarbamimidoyl)amino]phenyl]piperazin-1-yl]phenyl]guanidine;hydrochloride (PubChem CID 11757705) has the molecular formula C32H37ClN8 and a molecular weight of 569.16 g/mol. Its IUPAC name is 2-benzyl-1-[4-[4-[4-[(N'-benzylcarbamimidoyl)amino]phenyl]piperazin-1-yl]phenyl]guanidine;hydrochloride.
| Compound Name | 2-benzyl-1-[4-[4-[4-[(N'-benzylcarbamimidoyl)amino]phenyl]piperazin-1-yl]phenyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 11757705 |
| Molecular Formula | C32H37ClN8 |
| Molecular Weight | 569.16 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | 2-benzyl-1-[4-[4-[4-[(N'-benzylcarbamimidoyl)amino]phenyl]piperazin-1-yl]phenyl]guanidine;hydrochloride |
| SMILES | Cl.N/C(=N\Cc1ccccc1)Nc1ccc(N2CCN(c3ccc(N/C(N)=N/Cc4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H36N8.ClH/c33-31(35-23-25-7-3-1-4-8-25)37-27-11-15-29(16-12-27)39-19-21-40(22-20-39)30-17-13-28(14-18-30)38-32(34)36-24-26-9-5-2-6-10-26;/h1-18H,19-24H2,(H3,33,35,37)(H3,34,36,38);1H |
| InChIKey | RGUNYIXKURINAI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.16 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|