C20H25IN4 — CID 111816765
2-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-(4-ethylphenyl)guanidine;hydroiodide (PubChem CID 111816765) has the molecular formula C20H25IN4 and a molecular weight of 448.35 g/mol. Its IUPAC name is 2-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-(4-ethylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-(4-ethylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111816765 |
| Molecular Formula | C20H25IN4 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 2-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-(4-ethylphenyl)guanidine;hydroiodide |
| SMILES | CCc1ccc(N/C(N)=N/Cc2ccc(N3CC=CC3)cc2)cc1.I |
| InChI | InChI=1S/C20H24N4.HI/c1-2-16-5-9-18(10-6-16)23-20(21)22-15-17-7-11-19(12-8-17)24-13-3-4-14-24;/h3-12H,2,13-15H2,1H3,(H3,21,22,23);1H |
| InChIKey | OEUDVYWSYPZEMF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|