C23H30N4OS — CID 3814369
N-[[4-(4-benzylpiperazin-1-yl)phenyl]carbamothioyl]-3-methylbutanamide (PubChem CID 3814369) has the molecular formula C23H30N4OS and a molecular weight of 410.59 g/mol. Its IUPAC name is N-[[4-(4-benzylpiperazin-1-yl)phenyl]carbamothioyl]-3-methylbutanamide.
| Compound Name | N-[[4-(4-benzylpiperazin-1-yl)phenyl]carbamothioyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 3814369 |
| Molecular Formula | C23H30N4OS |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | N-[[4-(4-benzylpiperazin-1-yl)phenyl]carbamothioyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(=S)Nc1ccc(N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H30N4OS/c1-18(2)16-22(28)25-23(29)24-20-8-10-21(11-9-20)27-14-12-26(13-15-27)17-19-6-4-3-5-7-19/h3-11,18H,12-17H2,1-2H3,(H2,24,25,28,29) |
| InChIKey | QZZBSCKRIKUAMO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|