C20H23N3O2S — CID 1302093
N-[(4-morpholin-4-ylphenyl)carbamothioyl]-3-phenylpropanamide (PubChem CID 1302093) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is N-[(4-morpholin-4-ylphenyl)carbamothioyl]-3-phenylpropanamide.
| Compound Name | N-[(4-morpholin-4-ylphenyl)carbamothioyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 1302093 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[(4-morpholin-4-ylphenyl)carbamothioyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NC(=S)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H23N3O2S/c24-19(11-6-16-4-2-1-3-5-16)22-20(26)21-17-7-9-18(10-8-17)23-12-14-25-15-13-23/h1-5,7-10H,6,11-15H2,(H2,21,22,24,26) |
| InChIKey | FRVZPWBXFGAJHP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|