C14H20N4OS — CID 50879805
[4-(4-propanoylpiperazin-1-yl)phenyl]thiourea (PubChem CID 50879805) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is [4-(4-propanoylpiperazin-1-yl)phenyl]thiourea.
| Compound Name | [4-(4-propanoylpiperazin-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 50879805 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | [4-(4-propanoylpiperazin-1-yl)phenyl]thiourea |
| SMILES | CCC(=O)N1CCN(c2ccc(NC(N)=S)cc2)CC1 |
| InChI | InChI=1S/C14H20N4OS/c1-2-13(19)18-9-7-17(8-10-18)12-5-3-11(4-6-12)16-14(15)20/h3-6H,2,7-10H2,1H3,(H3,15,16,20) |
| InChIKey | USCSQKAQLVVUFR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|