C19H28N4O4 — CID 4899729
3-methyl-2-[[4-(4-propanoylpiperazin-1-yl)phenyl]carbamoylamino]butanoic acid (PubChem CID 4899729) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-methyl-2-[[4-(4-propanoylpiperazin-1-yl)phenyl]carbamoylamino]butanoic acid.
| Compound Name | 3-methyl-2-[[4-(4-propanoylpiperazin-1-yl)phenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 4899729 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 3-methyl-2-[[4-(4-propanoylpiperazin-1-yl)phenyl]carbamoylamino]butanoic acid |
| SMILES | CCC(=O)N1CCN(c2ccc(NC(=O)NC(C(=O)O)C(C)C)cc2)CC1 |
| InChI | InChI=1S/C19H28N4O4/c1-4-16(24)23-11-9-22(10-12-23)15-7-5-14(6-8-15)20-19(27)21-17(13(2)3)18(25)26/h5-8,13,17H,4,9-12H2,1-3H3,(H,25,26)(H2,20,21,27) |
| InChIKey | YPUXDFZLTQVOSC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|