C18H26N4O4 — CID 4870411
2-[[4-(4-butanoylpiperazin-1-yl)phenyl]carbamoylamino]propanoic acid (PubChem CID 4870411) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[[4-(4-butanoylpiperazin-1-yl)phenyl]carbamoylamino]propanoic acid.
| Compound Name | 2-[[4-(4-butanoylpiperazin-1-yl)phenyl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 4870411 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 2-[[4-(4-butanoylpiperazin-1-yl)phenyl]carbamoylamino]propanoic acid |
| SMILES | CCCC(=O)N1CCN(c2ccc(NC(=O)NC(C)C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C18H26N4O4/c1-3-4-16(23)22-11-9-21(10-12-22)15-7-5-14(6-8-15)20-18(26)19-13(2)17(24)25/h5-8,13H,3-4,9-12H2,1-2H3,(H,24,25)(H2,19,20,26) |
| InChIKey | XQKSQEQPJWCODJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|