C16H20Cl3N3O2 — CID 3807115
N-[4-(4-butanoylpiperazin-1-yl)phenyl]-2,2,2-trichloroacetamide (PubChem CID 3807115) has the molecular formula C16H20Cl3N3O2 and a molecular weight of 392.71 g/mol. Its IUPAC name is N-[4-(4-butanoylpiperazin-1-yl)phenyl]-2,2,2-trichloroacetamide.
| Compound Name | N-[4-(4-butanoylpiperazin-1-yl)phenyl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 3807115 |
| Molecular Formula | C16H20Cl3N3O2 |
| Molecular Weight | 392.71 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | N-[4-(4-butanoylpiperazin-1-yl)phenyl]-2,2,2-trichloroacetamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(NC(=O)C(Cl)(Cl)Cl)cc2)CC1 |
| InChI | InChI=1S/C16H20Cl3N3O2/c1-2-3-14(23)22-10-8-21(9-11-22)13-6-4-12(5-7-13)20-15(24)16(17,18)19/h4-7H,2-3,8-11H2,1H3,(H,20,24) |
| InChIKey | RVAVLLRQSWADPZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.71 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|