C15H18Cl3N3O2 — CID 3818372
2,2,2-trichloro-N-[4-(4-propanoylpiperazin-1-yl)phenyl]acetamide (PubChem CID 3818372) has the molecular formula C15H18Cl3N3O2 and a molecular weight of 378.69 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-(4-propanoylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-(4-propanoylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 3818372 |
| Molecular Formula | C15H18Cl3N3O2 |
| Molecular Weight | 378.69 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 2,2,2-trichloro-N-[4-(4-propanoylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CCC(=O)N1CCN(c2ccc(NC(=O)C(Cl)(Cl)Cl)cc2)CC1 |
| InChI | InChI=1S/C15H18Cl3N3O2/c1-2-13(22)21-9-7-20(8-10-21)12-5-3-11(4-6-12)19-14(23)15(16,17)18/h3-6H,2,7-10H2,1H3,(H,19,23) |
| InChIKey | LVRQCAAFDYSBCG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|