C18H28N4O3 — CID 4900081
methyl 3-methyl-2-[[4-(4-methylpiperazin-1-yl)phenyl]carbamoylamino]butanoate (PubChem CID 4900081) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is methyl 3-methyl-2-[[4-(4-methylpiperazin-1-yl)phenyl]carbamoylamino]butanoate.
| Compound Name | methyl 3-methyl-2-[[4-(4-methylpiperazin-1-yl)phenyl]carbamoylamino]butanoate |
|---|---|
| PubChem CID | 4900081 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | methyl 3-methyl-2-[[4-(4-methylpiperazin-1-yl)phenyl]carbamoylamino]butanoate |
| SMILES | COC(=O)C(NC(=O)Nc1ccc(N2CCN(C)CC2)cc1)C(C)C |
| InChI | InChI=1S/C18H28N4O3/c1-13(2)16(17(23)25-4)20-18(24)19-14-5-7-15(8-6-14)22-11-9-21(3)10-12-22/h5-8,13,16H,9-12H2,1-4H3,(H2,19,20,24) |
| InChIKey | ZBAVHMNGEQNWSV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|