C20H24Cl2N4O — CID 51945516
1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea (PubChem CID 51945516) has the molecular formula C20H24Cl2N4O and a molecular weight of 407.35 g/mol. Its IUPAC name is 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea.
| Compound Name | 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 51945516 |
| Molecular Formula | C20H24Cl2N4O |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea |
| SMILES | C[C@@H](NC(=O)Nc1ccc(N2CCN(C)CC2)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H24Cl2N4O/c1-14(18-8-3-15(21)13-19(18)22)23-20(27)24-16-4-6-17(7-5-16)26-11-9-25(2)10-12-26/h3-8,13-14H,9-12H2,1-2H3,(H2,23,24,27)/t14-/m1/s1 |
| InChIKey | KWKHMMLKGOERDE-CQSZACIVSA-N |
| XLogP | 4.63 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|