C18H19ClFN3O — CID 26709129
5-chloro-2-fluoro-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide (PubChem CID 26709129) has the molecular formula C18H19ClFN3O and a molecular weight of 347.82 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide.
| Compound Name | 5-chloro-2-fluoro-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 26709129 |
| Molecular Formula | C18H19ClFN3O |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 5-chloro-2-fluoro-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3cc(Cl)ccc3F)cc2)CC1 |
| InChI | InChI=1S/C18H19ClFN3O/c1-22-8-10-23(11-9-22)15-5-3-14(4-6-15)21-18(24)16-12-13(19)2-7-17(16)20/h2-7,12H,8-11H2,1H3,(H,21,24) |
| InChIKey | ZTXMDERBMDSUQH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|