C24H22Cl2FN3O — CID 3971845
2,5-dichloro-N-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]benzamide (PubChem CID 3971845) has the molecular formula C24H22Cl2FN3O and a molecular weight of 458.36 g/mol. Its IUPAC name is 2,5-dichloro-N-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]benzamide.
| Compound Name | 2,5-dichloro-N-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 3971845 |
| Molecular Formula | C24H22Cl2FN3O |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 2,5-dichloro-N-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccccc3F)CC2)cc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C24H22Cl2FN3O/c25-18-5-10-22(26)21(15-18)24(31)28-19-6-8-20(9-7-19)30-13-11-29(12-14-30)16-17-3-1-2-4-23(17)27/h1-10,15H,11-14,16H2,(H,28,31) |
| InChIKey | XHFSRUSVDWRSBX-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|