C23H29FN4O — CID 113107426
4-[(2-fluorophenyl)methyl]-N-(4-piperidin-1-ylphenyl)piperazine-1-carboxamide (PubChem CID 113107426) has the molecular formula C23H29FN4O and a molecular weight of 396.51 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)methyl]-N-(4-piperidin-1-ylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[(2-fluorophenyl)methyl]-N-(4-piperidin-1-ylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113107426 |
| Molecular Formula | C23H29FN4O |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 4-[(2-fluorophenyl)methyl]-N-(4-piperidin-1-ylphenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)N1CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C23H29FN4O/c24-22-7-3-2-6-19(22)18-26-14-16-28(17-15-26)23(29)25-20-8-10-21(11-9-20)27-12-4-1-5-13-27/h2-3,6-11H,1,4-5,12-18H2,(H,25,29) |
| InChIKey | BBJRYZJSIAVPAL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|