C24H22ClFN4O3 — CID 4520731
4-chloro-N-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]-3-nitrobenzamide (PubChem CID 4520731) has the molecular formula C24H22ClFN4O3 and a molecular weight of 468.92 g/mol. Its IUPAC name is 4-chloro-N-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4520731 |
| Molecular Formula | C24H22ClFN4O3 |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 4-chloro-N-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]-3-nitrobenzamide |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccccc3F)CC2)cc1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H22ClFN4O3/c25-21-10-5-17(15-23(21)30(32)33)24(31)27-19-6-8-20(9-7-19)29-13-11-28(12-14-29)16-18-3-1-2-4-22(18)26/h1-10,15H,11-14,16H2,(H,27,31) |
| InChIKey | JZQBSZVNGCJREZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|