C26H26FN5O3S — CID 17116332
N-[[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-2-methyl-3-nitrobenzamide (PubChem CID 17116332) has the molecular formula C26H26FN5O3S and a molecular weight of 507.59 g/mol. Its IUPAC name is N-[[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-2-methyl-3-nitrobenzamide.
| Compound Name | N-[[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17116332 |
| Molecular Formula | C26H26FN5O3S |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | N-[[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-2-methyl-3-nitrobenzamide |
| SMILES | Cc1c(C(=O)NC(=S)Nc2ccc(N3CCN(Cc4ccccc4F)CC3)cc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H26FN5O3S/c1-18-22(6-4-8-24(18)32(34)35)25(33)29-26(36)28-20-9-11-21(12-10-20)31-15-13-30(14-16-31)17-19-5-2-3-7-23(19)27/h2-12H,13-17H2,1H3,(H2,28,29,33,36) |
| InChIKey | DWOJCUOOAQNKTQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|