C26H25Cl2FN4O2S — CID 17318152
3,5-dichloro-N-[[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-4-methoxybenzamide (PubChem CID 17318152) has the molecular formula C26H25Cl2FN4O2S and a molecular weight of 547.48 g/mol. Its IUPAC name is 3,5-dichloro-N-[[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-[[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 17318152 |
| Molecular Formula | C26H25Cl2FN4O2S |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | 3,5-dichloro-N-[[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-4-methoxybenzamide |
| SMILES | COc1c(Cl)cc(C(=O)NC(=S)Nc2ccc(N3CCN(Cc4ccccc4F)CC3)cc2)cc1Cl |
| InChI | InChI=1S/C26H25Cl2FN4O2S/c1-35-24-21(27)14-18(15-22(24)28)25(34)31-26(36)30-19-6-8-20(9-7-19)33-12-10-32(11-13-33)16-17-4-2-3-5-23(17)29/h2-9,14-15H,10-13,16H2,1H3,(H2,30,31,34,36) |
| InChIKey | ZTZJLCYMYFUARI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|